C24H18Cl2N2O — CID 10093631
5-(2,4-dichlorophenyl)-2-methyl-N,1-diphenylpyrrole-3-carboxamide (PubChem CID 10093631) has the molecular formula C24H18Cl2N2O and a molecular weight of 421.33 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-2-methyl-N,1-diphenylpyrrole-3-carboxamide.
| Compound Name | 5-(2,4-dichlorophenyl)-2-methyl-N,1-diphenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 10093631 |
| Molecular Formula | C24H18Cl2N2O |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-2-methyl-N,1-diphenylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2)cc(-c2ccc(Cl)cc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C24H18Cl2N2O/c1-16-21(24(29)27-18-8-4-2-5-9-18)15-23(20-13-12-17(25)14-22(20)26)28(16)19-10-6-3-7-11-19/h2-15H,1H3,(H,27,29) |
| InChIKey | GFUYNRCUKFSYFF-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|