C21H16Cl2F3NO3 — CID 59671879
5-(2,4-dichlorophenyl)-2-methyl-1-[4-(3,3,3-trifluoropropoxy)phenyl]pyrrole-3-carboxylic acid (PubChem CID 59671879) has the molecular formula C21H16Cl2F3NO3 and a molecular weight of 458.26 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-2-methyl-1-[4-(3,3,3-trifluoropropoxy)phenyl]pyrrole-3-carboxylic acid.
| Compound Name | 5-(2,4-dichlorophenyl)-2-methyl-1-[4-(3,3,3-trifluoropropoxy)phenyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 59671879 |
| Molecular Formula | C21H16Cl2F3NO3 |
| Molecular Weight | 458.26 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-2-methyl-1-[4-(3,3,3-trifluoropropoxy)phenyl]pyrrole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cc(-c2ccc(Cl)cc2Cl)n1-c1ccc(OCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16Cl2F3NO3/c1-12-17(20(28)29)11-19(16-7-2-13(22)10-18(16)23)27(12)14-3-5-15(6-4-14)30-9-8-21(24,25)26/h2-7,10-11H,8-9H2,1H3,(H,28,29) |
| InChIKey | RACVXNUACKLKJX-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.26 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|