C26H26Cl2F3N3O2 — CID 69242691
5-(2,4-dichlorophenyl)-2-methyl-N-piperidin-1-yl-1-[2-(3,3,3-trifluoropropoxy)phenyl]pyrrole-3-carboxamide (PubChem CID 69242691) has the molecular formula C26H26Cl2F3N3O2 and a molecular weight of 540.41 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-2-methyl-N-piperidin-1-yl-1-[2-(3,3,3-trifluoropropoxy)phenyl]pyrrole-3-carboxamide.
| Compound Name | 5-(2,4-dichlorophenyl)-2-methyl-N-piperidin-1-yl-1-[2-(3,3,3-trifluoropropoxy)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 69242691 |
| Molecular Formula | C26H26Cl2F3N3O2 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-2-methyl-N-piperidin-1-yl-1-[2-(3,3,3-trifluoropropoxy)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)NN2CCCCC2)cc(-c2ccc(Cl)cc2Cl)n1-c1ccccc1OCCC(F)(F)F |
| InChI | InChI=1S/C26H26Cl2F3N3O2/c1-17-20(25(35)32-33-12-5-2-6-13-33)16-23(19-10-9-18(27)15-21(19)28)34(17)22-7-3-4-8-24(22)36-14-11-26(29,30)31/h3-4,7-10,15-16H,2,5-6,11-14H2,1H3,(H,32,35) |
| InChIKey | RUARMQVWJGNJIO-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|