C18H13F3N2O4S2 — CID 2742504
4-(4-nitrophenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfonylmethyl]-1,3-thiazole (PubChem CID 2742504) has the molecular formula C18H13F3N2O4S2 and a molecular weight of 442.44 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfonylmethyl]-1,3-thiazole.
| Compound Name | 4-(4-nitrophenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfonylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 2742504 |
| Molecular Formula | C18H13F3N2O4S2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-(4-nitrophenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfonylmethyl]-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2csc(CS(=O)(=O)Cc3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C18H13F3N2O4S2/c19-18(20,21)14-3-1-2-12(8-14)10-29(26,27)11-17-22-16(9-28-17)13-4-6-15(7-5-13)23(24)25/h1-9H,10-11H2 |
| InChIKey | JOVAXDZBFHQPNF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 90.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|