C18H14ClNO2 — CID 2742876
N-(2-chlorophenyl)-2-methyl-5-phenylfuran-3-carboxamide (PubChem CID 2742876) has the molecular formula C18H14ClNO2 and a molecular weight of 311.77 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-methyl-5-phenylfuran-3-carboxamide.
| Compound Name | N-(2-chlorophenyl)-2-methyl-5-phenylfuran-3-carboxamide |
|---|---|
| PubChem CID | 2742876 |
| Molecular Formula | C18H14ClNO2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-(2-chlorophenyl)-2-methyl-5-phenylfuran-3-carboxamide |
| SMILES | Cc1oc(-c2ccccc2)cc1C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C18H14ClNO2/c1-12-14(11-17(22-12)13-7-3-2-4-8-13)18(21)20-16-10-6-5-9-15(16)19/h2-11H,1H3,(H,20,21) |
| InChIKey | MXSNUVXQMXZSKY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |