C19H14F3NO2 — CID 16650690
2-methyl-5-phenyl-N-[2-(trifluoromethyl)phenyl]furan-3-carboxamide (PubChem CID 16650690) has the molecular formula C19H14F3NO2 and a molecular weight of 345.32 g/mol. Its IUPAC name is 2-methyl-5-phenyl-N-[2-(trifluoromethyl)phenyl]furan-3-carboxamide.
| Compound Name | 2-methyl-5-phenyl-N-[2-(trifluoromethyl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 16650690 |
| Molecular Formula | C19H14F3NO2 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-methyl-5-phenyl-N-[2-(trifluoromethyl)phenyl]furan-3-carboxamide |
| SMILES | Cc1oc(-c2ccccc2)cc1C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H14F3NO2/c1-12-14(11-17(25-12)13-7-3-2-4-8-13)18(24)23-16-10-6-5-9-15(16)19(20,21)22/h2-11H,1H3,(H,23,24) |
| InChIKey | BRYNWJOURLAFRY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |