C18H17BrFNO3S — CID 27432973
[(2S)-1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] (2S)-2-phenylsulfanylpropanoate (PubChem CID 27432973) has the molecular formula C18H17BrFNO3S and a molecular weight of 426.31 g/mol. Its IUPAC name is [(2S)-1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] (2S)-2-phenylsulfanylpropanoate.
| Compound Name | [(2S)-1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] (2S)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 27432973 |
| Molecular Formula | C18H17BrFNO3S |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | [(2S)-1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] (2S)-2-phenylsulfanylpropanoate |
| SMILES | C[C@H](OC(=O)[C@H](C)Sc1ccccc1)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C18H17BrFNO3S/c1-11(17(22)21-16-9-8-13(19)10-15(16)20)24-18(23)12(2)25-14-6-4-3-5-7-14/h3-12H,1-2H3,(H,21,22)/t11-,12-/m0/s1 |
| InChIKey | SKPFGARUFCSHDX-RYUDHWBXSA-N |
| XLogP | 4.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |