C20H15BrFNO4 — CID 24520584
[1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] 3-phenylfuran-2-carboxylate (PubChem CID 24520584) has the molecular formula C20H15BrFNO4 and a molecular weight of 432.25 g/mol. Its IUPAC name is [1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] 3-phenylfuran-2-carboxylate.
| Compound Name | [1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] 3-phenylfuran-2-carboxylate |
|---|---|
| PubChem CID | 24520584 |
| Molecular Formula | C20H15BrFNO4 |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | [1-(4-bromo-2-fluoroanilino)-1-oxopropan-2-yl] 3-phenylfuran-2-carboxylate |
| SMILES | CC(OC(=O)c1occc1-c1ccccc1)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C20H15BrFNO4/c1-12(19(24)23-17-8-7-14(21)11-16(17)22)27-20(25)18-15(9-10-26-18)13-5-3-2-4-6-13/h2-12H,1H3,(H,23,24) |
| InChIKey | MPMCQWFVBHKDDE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |