C18H26N4O2S — CID 2743968
2-[(5-oxo-4-pentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 2743968) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-[(5-oxo-4-pentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(5-oxo-4-pentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2743968 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[(5-oxo-4-pentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CCCCCn1c(SCC(=O)Nc2ccc(C(C)C)cc2)n[nH]c1=O |
| InChI | InChI=1S/C18H26N4O2S/c1-4-5-6-11-22-17(24)20-21-18(22)25-12-16(23)19-15-9-7-14(8-10-15)13(2)3/h7-10,13H,4-6,11-12H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | RFWYNNZTFOGVNA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|