C15H18N4O5 — CID 27440534
N'-(2,2-dimethoxyethyl)-N-[(4-oxo-3H-phthalazin-1-yl)methyl]oxamide (PubChem CID 27440534) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)-N-[(4-oxo-3H-phthalazin-1-yl)methyl]oxamide.
| Compound Name | N'-(2,2-dimethoxyethyl)-N-[(4-oxo-3H-phthalazin-1-yl)methyl]oxamide |
|---|---|
| PubChem CID | 27440534 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)-N-[(4-oxo-3H-phthalazin-1-yl)methyl]oxamide |
| SMILES | COC(CNC(=O)C(=O)NCc1n[nH]c(=O)c2ccccc12)OC |
| InChI | InChI=1S/C15H18N4O5/c1-23-12(24-2)8-17-15(22)14(21)16-7-11-9-5-3-4-6-10(9)13(20)19-18-11/h3-6,12H,7-8H2,1-2H3,(H,16,21)(H,17,22)(H,19,20) |
| InChIKey | XGFPKKVYVDWDIJ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|