C17H22N4O5 — CID 43996590
N',N'-bis(2-methoxyethyl)-N-[(4-oxo-3H-phthalazin-1-yl)methyl]oxamide (PubChem CID 43996590) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is N',N'-bis(2-methoxyethyl)-N-[(4-oxo-3H-phthalazin-1-yl)methyl]oxamide.
| Compound Name | N',N'-bis(2-methoxyethyl)-N-[(4-oxo-3H-phthalazin-1-yl)methyl]oxamide |
|---|---|
| PubChem CID | 43996590 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N',N'-bis(2-methoxyethyl)-N-[(4-oxo-3H-phthalazin-1-yl)methyl]oxamide |
| SMILES | COCCN(CCOC)C(=O)C(=O)NCc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H22N4O5/c1-25-9-7-21(8-10-26-2)17(24)16(23)18-11-14-12-5-3-4-6-13(12)15(22)20-19-14/h3-6H,7-11H2,1-2H3,(H,18,23)(H,20,22) |
| InChIKey | BQXGWEWNSURLJG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|