C21H21ClN2O2 — CID 2744523
(4-chlorophenyl) 1-benzyl-3-tert-butylpyrazole-5-carboxylate (PubChem CID 2744523) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is (4-chlorophenyl) 1-benzyl-3-tert-butylpyrazole-5-carboxylate.
| Compound Name | (4-chlorophenyl) 1-benzyl-3-tert-butylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 2744523 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (4-chlorophenyl) 1-benzyl-3-tert-butylpyrazole-5-carboxylate |
| SMILES | CC(C)(C)c1cc(C(=O)Oc2ccc(Cl)cc2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H21ClN2O2/c1-21(2,3)19-13-18(20(25)26-17-11-9-16(22)10-12-17)24(23-19)14-15-7-5-4-6-8-15/h4-13H,14H2,1-3H3 |
| InChIKey | SNHBNMGONRXDBJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|