C8H5F3N4 — CID 2744601
2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)pyridine (PubChem CID 2744601) has the molecular formula C8H5F3N4 and a molecular weight of 214.15 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)pyridine.
| Compound Name | 2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 2744601 |
| Molecular Formula | C8H5F3N4 |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(-n2cncn2)nc1 |
| InChI | InChI=1S/C8H5F3N4/c9-8(10,11)6-1-2-7(13-3-6)15-5-12-4-14-15/h1-5H |
| InChIKey | LUWGRVMBUSNLRR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |