C8H7N5 — CID 6858569
(E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6858569) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6858569 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | C(=N/n1cnnc1)\c1cccnc1 |
| InChI | InChI=1S/C8H7N5/c1-2-8(4-9-3-1)5-12-13-6-10-11-7-13/h1-7H/b12-5+ |
| InChIKey | PVGQEZUQBQXWED-LFYBBSHMSA-N |
| XLogP | 0.56 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|