About (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine
(E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6858569) has the molecular formula C8H7N5
and a molecular weight of 173.18 g/mol. Its IUPAC name is (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine.
Molecular Properties
| Compound Name | (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine |
| PubChem CID | 6858569 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | C(=N/n1cnnc1)\c1cccnc1 |
| InChI | InChI=1S/C8H7N5/c1-2-8(4-9-3-1)5-12-13-6-10-11-7-13/h1-7H/b12-5+ |
| InChIKey | PVGQEZUQBQXWED-LFYBBSHMSA-N |
| XLogP | 0.56 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine?
The IUPAC name of (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine (CID 6858569) is (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine.
What is the SMILES notation for (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine?
The canonical SMILES for (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine is C(=N/n1cnnc1)\c1cccnc1.
What is the InChIKey of (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine?
The InChIKey is PVGQEZUQBQXWED-LFYBBSHMSA-N. The full InChI is InChI=1S/C8H7N5/c1-2-8(4-9-3-1)5-12-13-6-10-11-7-13/h1-7H/b12-5+.
What are the key properties of (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine?
(E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine has a molecular weight of 173.18 g/mol, XLogP of 0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-pyridin-3-yl-N-(1,2,4-triazol-4-yl)methanimine is sourced from PubChem (CID 6858569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).