C19H22N4OS — CID 27448120
N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 27448120) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-2-methylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-2-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 27448120 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-3-methylbutyl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)N[C@H](CC(C)C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H22N4OS/c1-12(2)11-16(17-21-14-8-4-5-9-15(14)22-17)23-18(24)13-7-6-10-20-19(13)25-3/h4-10,12,16H,11H2,1-3H3,(H,21,22)(H,23,24)/t16-/m1/s1 |
| InChIKey | UHBGGKRJLQEJDT-MRXNPFEDSA-N |
| XLogP | 4.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |