C10H17N3O2S — CID 27450760
3-(2-hydroxypropan-2-yl)-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 27450760) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-(2-hydroxypropan-2-yl)-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-hydroxypropan-2-yl)-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 27450760 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-(2-hydroxypropan-2-yl)-4-[[(2S)-oxolan-2-yl]methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(O)c1n[nH]c(=S)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C10H17N3O2S/c1-10(2,14)8-11-12-9(16)13(8)6-7-4-3-5-15-7/h7,14H,3-6H2,1-2H3,(H,12,16)/t7-/m0/s1 |
| InChIKey | NBJMILBCBFLMJT-ZETCQYMHSA-N |
| XLogP | 1.35 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|