C15H19N3OS2 — CID 45158214
4-(oxolan-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 45158214) has the molecular formula C15H19N3OS2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 4-(oxolan-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(oxolan-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 45158214 |
| Molecular Formula | C15H19N3OS2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-(oxolan-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2csc3c2CCCC3)n1CC1CCCO1 |
| InChI | InChI=1S/C15H19N3OS2/c20-15-17-16-14(18(15)8-10-4-3-7-19-10)12-9-21-13-6-2-1-5-11(12)13/h9-10H,1-8H2,(H,17,20) |
| InChIKey | GJSCARDWRAFNHO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|