C20H24FNO3S — CID 27451515
N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 27451515) has the molecular formula C20H24FNO3S and a molecular weight of 377.48 g/mol. Its IUPAC name is N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 27451515 |
| Molecular Formula | C20H24FNO3S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCC2(c3ccc(F)cc3)CCOCC2)c1 |
| InChI | InChI=1S/C20H24FNO3S/c1-15-3-4-16(2)19(13-15)26(23,24)22-14-20(9-11-25-12-10-20)17-5-7-18(21)8-6-17/h3-8,13,22H,9-12,14H2,1-2H3 |
| InChIKey | ZXDYZSNKWFSUOY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |