C13H14N2O2S — CID 2745204
piperidin-1-yl-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone (PubChem CID 2745204) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is piperidin-1-yl-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone.
| Compound Name | piperidin-1-yl-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 2745204 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | piperidin-1-yl-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1cc(-c2cccs2)on1)N1CCCCC1 |
| InChI | InChI=1S/C13H14N2O2S/c16-13(15-6-2-1-3-7-15)10-9-11(17-14-10)12-5-4-8-18-12/h4-5,8-9H,1-3,6-7H2 |
| InChIKey | LCIGQGPHUWDYGN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |