C17H21N3O5 — CID 2745692
methyl 5-(dimethoxymethyl)-1-[(2,6-dimethylphenyl)carbamoyl]pyrazole-4-carboxylate (PubChem CID 2745692) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl 5-(dimethoxymethyl)-1-[(2,6-dimethylphenyl)carbamoyl]pyrazole-4-carboxylate.
| Compound Name | methyl 5-(dimethoxymethyl)-1-[(2,6-dimethylphenyl)carbamoyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2745692 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | methyl 5-(dimethoxymethyl)-1-[(2,6-dimethylphenyl)carbamoyl]pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(C(=O)Nc2c(C)cccc2C)c1C(OC)OC |
| InChI | InChI=1S/C17H21N3O5/c1-10-7-6-8-11(2)13(10)19-17(22)20-14(16(24-4)25-5)12(9-18-20)15(21)23-3/h6-9,16H,1-5H3,(H,19,22) |
| InChIKey | SELJWDWFZLANKU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|