C14H14Cl2N2O4 — CID 2745752
methyl 1-(2,6-dichlorophenyl)-5-(dimethoxymethyl)pyrazole-4-carboxylate (PubChem CID 2745752) has the molecular formula C14H14Cl2N2O4 and a molecular weight of 345.18 g/mol. Its IUPAC name is methyl 1-(2,6-dichlorophenyl)-5-(dimethoxymethyl)pyrazole-4-carboxylate.
| Compound Name | methyl 1-(2,6-dichlorophenyl)-5-(dimethoxymethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2745752 |
| Molecular Formula | C14H14Cl2N2O4 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | methyl 1-(2,6-dichlorophenyl)-5-(dimethoxymethyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(-c2c(Cl)cccc2Cl)c1C(OC)OC |
| InChI | InChI=1S/C14H14Cl2N2O4/c1-20-13(19)8-7-17-18(11(8)14(21-2)22-3)12-9(15)5-4-6-10(12)16/h4-7,14H,1-3H3 |
| InChIKey | PHQVGRIHLUMAJF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|