C18H16ClN3O2 — CID 2745789
4-(4-chlorophenoxy)-3,5-dimethyl-N-phenylpyrazole-1-carboxamide (PubChem CID 2745789) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-3,5-dimethyl-N-phenylpyrazole-1-carboxamide.
| Compound Name | 4-(4-chlorophenoxy)-3,5-dimethyl-N-phenylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 2745789 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 4-(4-chlorophenoxy)-3,5-dimethyl-N-phenylpyrazole-1-carboxamide |
| SMILES | Cc1nn(C(=O)Nc2ccccc2)c(C)c1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O2/c1-12-17(24-16-10-8-14(19)9-11-16)13(2)22(21-12)18(23)20-15-6-4-3-5-7-15/h3-11H,1-2H3,(H,20,23) |
| InChIKey | QVTBVHORDRBWAB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |