C29H22ClN3O2 — CID 57036576
3-(4-chlorophenyl)-4-(4-methylphenyl)-N-(4-phenoxyphenyl)pyrazole-1-carboxamide (PubChem CID 57036576) has the molecular formula C29H22ClN3O2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(4-methylphenyl)-N-(4-phenoxyphenyl)pyrazole-1-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-4-(4-methylphenyl)-N-(4-phenoxyphenyl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 57036576 |
| Molecular Formula | C29H22ClN3O2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(4-methylphenyl)-N-(4-phenoxyphenyl)pyrazole-1-carboxamide |
| SMILES | Cc1ccc(-c2cn(C(=O)Nc3ccc(Oc4ccccc4)cc3)nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H22ClN3O2/c1-20-7-9-21(10-8-20)27-19-33(32-28(27)22-11-13-23(30)14-12-22)29(34)31-24-15-17-26(18-16-24)35-25-5-3-2-4-6-25/h2-19H,1H3,(H,31,34) |
| InChIKey | NPXCJOHGVIGGHM-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |