C20H17ClN2OS — CID 2745793
1-[4-benzylsulfanyl-2-(4-chlorophenyl)-6-methylpyrimidin-5-yl]ethanone (PubChem CID 2745793) has the molecular formula C20H17ClN2OS and a molecular weight of 368.89 g/mol. Its IUPAC name is 1-[4-benzylsulfanyl-2-(4-chlorophenyl)-6-methylpyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-benzylsulfanyl-2-(4-chlorophenyl)-6-methylpyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 2745793 |
| Molecular Formula | C20H17ClN2OS |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-[4-benzylsulfanyl-2-(4-chlorophenyl)-6-methylpyrimidin-5-yl]ethanone |
| SMILES | CC(=O)c1c(C)nc(-c2ccc(Cl)cc2)nc1SCc1ccccc1 |
| InChI | InChI=1S/C20H17ClN2OS/c1-13-18(14(2)24)20(25-12-15-6-4-3-5-7-15)23-19(22-13)16-8-10-17(21)11-9-16/h3-11H,12H2,1-2H3 |
| InChIKey | AMIRKYYODDGKCC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |