C16H17ClN4O — CID 3241779
N'-[5-acetyl-2-(4-chlorophenyl)-6-methylpyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 3241779) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is N'-[5-acetyl-2-(4-chlorophenyl)-6-methylpyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-acetyl-2-(4-chlorophenyl)-6-methylpyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 3241779 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N'-[5-acetyl-2-(4-chlorophenyl)-6-methylpyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CC(=O)c1c(C)nc(-c2ccc(Cl)cc2)nc1/N=C/N(C)C |
| InChI | InChI=1S/C16H17ClN4O/c1-10-14(11(2)22)16(18-9-21(3)4)20-15(19-10)12-5-7-13(17)8-6-12/h5-9H,1-4H3/b18-9+ |
| InChIKey | DOKHPKPKRPPPSC-GIJQJNRQSA-N |
| XLogP | 3.53 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|