C16H25NO2 — CID 27459810
N-[(1S,2R)-2-tert-butylcyclohexyl]-5-methylfuran-2-carboxamide (PubChem CID 27459810) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-[(1S,2R)-2-tert-butylcyclohexyl]-5-methylfuran-2-carboxamide.
| Compound Name | N-[(1S,2R)-2-tert-butylcyclohexyl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 27459810 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-[(1S,2R)-2-tert-butylcyclohexyl]-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2CCCC[C@@H]2C(C)(C)C)o1 |
| InChI | InChI=1S/C16H25NO2/c1-11-9-10-14(19-11)15(18)17-13-8-6-5-7-12(13)16(2,3)4/h9-10,12-13H,5-8H2,1-4H3,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | NFMWRTSTDGZMMI-STQMWFEESA-N |
| XLogP | 3.92 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |