C11H12ClN3OS — CID 27460639
3-[(1R)-1-(2-chlorophenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 27460639) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is 3-[(1R)-1-(2-chlorophenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(1R)-1-(2-chlorophenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 27460639 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3-[(1R)-1-(2-chlorophenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | C[C@@H](Oc1ccccc1Cl)c1n[nH]c(=S)n1C |
| InChI | InChI=1S/C11H12ClN3OS/c1-7(10-13-14-11(17)15(10)2)16-9-6-4-3-5-8(9)12/h3-7H,1-2H3,(H,14,17)/t7-/m1/s1 |
| InChIKey | POHYALIYKUTVNP-SSDOTTSWSA-N |
| XLogP | 3.27 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|