C22H17ClF3N3O3 — CID 2746269
[[1-amino-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]phenyl]ethylidene]amino] benzoate (PubChem CID 2746269) has the molecular formula C22H17ClF3N3O3 and a molecular weight of 463.84 g/mol. Its IUPAC name is [[1-amino-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]phenyl]ethylidene]amino] benzoate.
| Compound Name | [[1-amino-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]phenyl]ethylidene]amino] benzoate |
|---|---|
| PubChem CID | 2746269 |
| Molecular Formula | C22H17ClF3N3O3 |
| Molecular Weight | 463.84 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | [[1-amino-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methoxy]phenyl]ethylidene]amino] benzoate |
| SMILES | NC(Cc1ccc(OCc2ncc(C(F)(F)F)cc2Cl)cc1)=NOC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H17ClF3N3O3/c23-18-11-16(22(24,25)26)12-28-19(18)13-31-17-8-6-14(7-9-17)10-20(27)29-32-21(30)15-4-2-1-3-5-15/h1-9,11-12H,10,13H2,(H2,27,29) |
| InChIKey | WZHIUBYBTSDOLM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.84 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|