C18H18N2 — CID 2747
2-(2,2-diphenylcyclopropyl)-4,5-dihydro-1H-imidazole (PubChem CID 2747) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-(2,2-diphenylcyclopropyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 2-(2,2-diphenylcyclopropyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 2747 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-(2,2-diphenylcyclopropyl)-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc(C2(c3ccccc3)CC2C2=NCCN2)cc1 |
| InChI | InChI=1S/C18H18N2/c1-3-7-14(8-4-1)18(15-9-5-2-6-10-15)13-16(18)17-19-11-12-20-17/h1-10,16H,11-13H2,(H,19,20) |
| InChIKey | IPOBOOXFSRWSHL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |