C15H24N2OS — CID 27474422
1-[(1S)-1-(3,4-dimethylphenyl)ethyl]-3-(3-methoxypropyl)thiourea (PubChem CID 27474422) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4-dimethylphenyl)ethyl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[(1S)-1-(3,4-dimethylphenyl)ethyl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 27474422 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-[(1S)-1-(3,4-dimethylphenyl)ethyl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)N[C@@H](C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H24N2OS/c1-11-6-7-14(10-12(11)2)13(3)17-15(19)16-8-5-9-18-4/h6-7,10,13H,5,8-9H2,1-4H3,(H2,16,17,19)/t13-/m0/s1 |
| InChIKey | WOKWWQCPKCFHPZ-ZDUSSCGKSA-N |
| XLogP | 2.87 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|