C17H10Cl2N4O — CID 2747555
2-chloro-N-[1-(4-chloroanilino)-2,2-dicyanoethenyl]benzamide (PubChem CID 2747555) has the molecular formula C17H10Cl2N4O and a molecular weight of 357.20 g/mol. Its IUPAC name is 2-chloro-N-[1-(4-chloroanilino)-2,2-dicyanoethenyl]benzamide.
| Compound Name | 2-chloro-N-[1-(4-chloroanilino)-2,2-dicyanoethenyl]benzamide |
|---|---|
| PubChem CID | 2747555 |
| Molecular Formula | C17H10Cl2N4O |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2-chloro-N-[1-(4-chloroanilino)-2,2-dicyanoethenyl]benzamide |
| SMILES | N#CC(C#N)=C(NC(=O)c1ccccc1Cl)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H10Cl2N4O/c18-12-5-7-13(8-6-12)22-16(11(9-20)10-21)23-17(24)14-3-1-2-4-15(14)19/h1-8,22H,(H,23,24) |
| InChIKey | RUGPPOPMCQPTCW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|