C15H10Cl2N2O3 — CID 2726843
N'-(2-chlorobenzoyl)-N-(4-chlorophenyl)oxamide (PubChem CID 2726843) has the molecular formula C15H10Cl2N2O3 and a molecular weight of 337.16 g/mol. Its IUPAC name is N'-(2-chlorobenzoyl)-N-(4-chlorophenyl)oxamide.
| Compound Name | N'-(2-chlorobenzoyl)-N-(4-chlorophenyl)oxamide |
|---|---|
| PubChem CID | 2726843 |
| Molecular Formula | C15H10Cl2N2O3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N'-(2-chlorobenzoyl)-N-(4-chlorophenyl)oxamide |
| SMILES | O=C(NC(=O)c1ccccc1Cl)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10Cl2N2O3/c16-9-5-7-10(8-6-9)18-14(21)15(22)19-13(20)11-3-1-2-4-12(11)17/h1-8H,(H,18,21)(H,19,20,22) |
| InChIKey | VLEVWKRTWXWDGW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|