C16H17NO3S — CID 2748353
ethyl 2-(2-formylpyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 2748353) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is ethyl 2-(2-formylpyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-(2-formylpyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 2748353 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | ethyl 2-(2-formylpyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-n2cccc2C=O)sc2c1CCCC2 |
| InChI | InChI=1S/C16H17NO3S/c1-2-20-16(19)14-12-7-3-4-8-13(12)21-15(14)17-9-5-6-11(17)10-18/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | UOXAUTLWKPQCRA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|