About 2-methyl-1,4-dinitrosobenzene
2-methyl-1,4-dinitrosobenzene (PubChem CID 2749266) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is 2-methyl-1,4-dinitrosobenzene.
Molecular Properties
| Compound Name | 2-methyl-1,4-dinitrosobenzene |
| PubChem CID | 2749266 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 2-methyl-1,4-dinitrosobenzene |
| SMILES | Cc1cc(N=O)ccc1N=O |
| InChI | InChI=1S/C7H6N2O2/c1-5-4-6(8-10)2-3-7(5)9-11/h2-4H,1H3 |
| InChIKey | XMQHFKGYFIMGMV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-1,4-dinitrosobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,4-dinitrosobenzene?
The IUPAC name of 2-methyl-1,4-dinitrosobenzene (CID 2749266) is 2-methyl-1,4-dinitrosobenzene.
What is the SMILES notation for 2-methyl-1,4-dinitrosobenzene?
The canonical SMILES for 2-methyl-1,4-dinitrosobenzene is Cc1cc(N=O)ccc1N=O.
What is the InChIKey of 2-methyl-1,4-dinitrosobenzene?
The InChIKey is XMQHFKGYFIMGMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c1-5-4-6(8-10)2-3-7(5)9-11/h2-4H,1H3.
What are the key properties of 2-methyl-1,4-dinitrosobenzene?
2-methyl-1,4-dinitrosobenzene has a molecular weight of 150.14 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,4-dinitrosobenzene is sourced from PubChem (CID 2749266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).