C28H20Br2N4O2 — CID 2749675
6-bromo-1-[[5-[(6-bromo-2-hydroxynaphthalen-1-yl)diazenyl]-2,4-dimethylphenyl]diazenyl]naphthalen-2-ol (PubChem CID 2749675) has the molecular formula C28H20Br2N4O2 and a molecular weight of 604.30 g/mol. Its IUPAC name is 6-bromo-1-[[5-[(6-bromo-2-hydroxynaphthalen-1-yl)diazenyl]-2,4-dimethylphenyl]diazenyl]naphthalen-2-ol.
| Compound Name | 6-bromo-1-[[5-[(6-bromo-2-hydroxynaphthalen-1-yl)diazenyl]-2,4-dimethylphenyl]diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 2749675 |
| Molecular Formula | C28H20Br2N4O2 |
| Molecular Weight | 604.30 g/mol |
| Exact Mass | 602.00 |
| IUPAC Name | 6-bromo-1-[[5-[(6-bromo-2-hydroxynaphthalen-1-yl)diazenyl]-2,4-dimethylphenyl]diazenyl]naphthalen-2-ol |
| SMILES | Cc1cc(C)c(/N=N/c2c(O)ccc3cc(Br)ccc23)cc1/N=N/c1c(O)ccc2cc(Br)ccc12 |
| InChI | InChI=1S/C28H20Br2N4O2/c1-15-11-16(2)24(32-34-28-22-8-6-20(30)13-18(22)4-10-26(28)36)14-23(15)31-33-27-21-7-5-19(29)12-17(21)3-9-25(27)35/h3-14,35-36H,1-2H3/b33-31+,34-32+ |
| InChIKey | IXNDVNHTHMKJMN-FMWAKIAMSA-N |
| XLogP | 10.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.30 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|