C18H17ClN2OS — CID 27518680
(E)-3-(5-chlorothiophen-2-yl)-2-cyano-N-[(1R)-1-(2,5-dimethylphenyl)ethyl]prop-2-enamide (PubChem CID 27518680) has the molecular formula C18H17ClN2OS and a molecular weight of 344.87 g/mol. Its IUPAC name is (E)-3-(5-chlorothiophen-2-yl)-2-cyano-N-[(1R)-1-(2,5-dimethylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-chlorothiophen-2-yl)-2-cyano-N-[(1R)-1-(2,5-dimethylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 27518680 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (E)-3-(5-chlorothiophen-2-yl)-2-cyano-N-[(1R)-1-(2,5-dimethylphenyl)ethyl]prop-2-enamide |
| SMILES | Cc1ccc(C)c([C@@H](C)NC(=O)/C(C#N)=C/c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C18H17ClN2OS/c1-11-4-5-12(2)16(8-11)13(3)21-18(22)14(10-20)9-15-6-7-17(19)23-15/h4-9,13H,1-3H3,(H,21,22)/b14-9+/t13-/m1/s1 |
| InChIKey | LBTWLYXVRHYZRV-OZYJXZHSSA-N |
| XLogP | 4.80 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|