C16H25N3O2S2 — CID 27519312
1-[4-[(2R)-2-methylpiperidin-1-yl]sulfonylphenyl]-3-propan-2-ylthiourea (PubChem CID 27519312) has the molecular formula C16H25N3O2S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-[4-[(2R)-2-methylpiperidin-1-yl]sulfonylphenyl]-3-propan-2-ylthiourea.
| Compound Name | 1-[4-[(2R)-2-methylpiperidin-1-yl]sulfonylphenyl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 27519312 |
| Molecular Formula | C16H25N3O2S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[4-[(2R)-2-methylpiperidin-1-yl]sulfonylphenyl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C16H25N3O2S2/c1-12(2)17-16(22)18-14-7-9-15(10-8-14)23(20,21)19-11-5-4-6-13(19)3/h7-10,12-13H,4-6,11H2,1-3H3,(H2,17,18,22)/t13-/m1/s1 |
| InChIKey | ZZUOLGTVIVDMFF-CYBMUJFWSA-N |
| XLogP | 2.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|