C28H23N3O6 — CID 27532061
(5R,6R,7S,8S)-6-(1,3-benzodioxole-5-carbonyl)-7-(3-nitrophenyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one (PubChem CID 27532061) has the molecular formula C28H23N3O6 and a molecular weight of 497.51 g/mol. Its IUPAC name is (5R,6R,7S,8S)-6-(1,3-benzodioxole-5-carbonyl)-7-(3-nitrophenyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one.
| Compound Name | (5R,6R,7S,8S)-6-(1,3-benzodioxole-5-carbonyl)-7-(3-nitrophenyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 27532061 |
| Molecular Formula | C28H23N3O6 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (5R,6R,7S,8S)-6-(1,3-benzodioxole-5-carbonyl)-7-(3-nitrophenyl)spiro[1,2,3,6,7,8-hexahydropyrrolizine-5,3'-1H-indole]-2'-one |
| SMILES | O=C(c1ccc2c(c1)OCO2)[C@@H]1[C@@H](c2cccc([N+](=O)[O-])c2)[C@@H]2CCCN2[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C28H23N3O6/c32-26(17-10-11-22-23(14-17)37-15-36-22)25-24(16-5-3-6-18(13-16)31(34)35)21-9-4-12-30(21)28(25)19-7-1-2-8-20(19)29-27(28)33/h1-3,5-8,10-11,13-14,21,24-25H,4,9,12,15H2,(H,29,33)/t21-,24-,25-,28-/m0/s1 |
| InChIKey | DNHIPCVCHGGQRF-WWZJJOFDSA-N |
| XLogP | 4.23 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|