C24H19N3O4S2 — CID 4859820
7'-(3-nitrophenyl)-6'-(thiophene-2-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one (PubChem CID 4859820) has the molecular formula C24H19N3O4S2 and a molecular weight of 477.57 g/mol. Its IUPAC name is 7'-(3-nitrophenyl)-6'-(thiophene-2-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one.
| Compound Name | 7'-(3-nitrophenyl)-6'-(thiophene-2-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
|---|---|
| PubChem CID | 4859820 |
| Molecular Formula | C24H19N3O4S2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 7'-(3-nitrophenyl)-6'-(thiophene-2-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
| SMILES | O=C(c1cccs1)C1C(c2cccc([N+](=O)[O-])c2)C2CSCN2C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C24H19N3O4S2/c28-22(19-9-4-10-33-19)21-20(14-5-3-6-15(11-14)27(30)31)18-12-32-13-26(18)24(21)16-7-1-2-8-17(16)25-23(24)29/h1-11,18,20-21H,12-13H2,(H,25,29) |
| InChIKey | WIYGUJNNCFACAI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|