C28H25N3O4S — CID 40980020
(3S,6'R,7'R,7'aS)-6'-benzoyl-5,7-dimethyl-7'-(3-nitrophenyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one (PubChem CID 40980020) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is (3S,6'R,7'R,7'aS)-6'-benzoyl-5,7-dimethyl-7'-(3-nitrophenyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one.
| Compound Name | (3S,6'R,7'R,7'aS)-6'-benzoyl-5,7-dimethyl-7'-(3-nitrophenyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
|---|---|
| PubChem CID | 40980020 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | (3S,6'R,7'R,7'aS)-6'-benzoyl-5,7-dimethyl-7'-(3-nitrophenyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
| SMILES | Cc1cc(C)c2c(c1)[C@]1(C(=O)N2)[C@H](C(=O)c2ccccc2)[C@H](c2cccc([N+](=O)[O-])c2)[C@H]2CSCN21 |
| InChI | InChI=1S/C28H25N3O4S/c1-16-11-17(2)25-21(12-16)28(27(33)29-25)24(26(32)18-7-4-3-5-8-18)23(22-14-36-15-30(22)28)19-9-6-10-20(13-19)31(34)35/h3-13,22-24H,14-15H2,1-2H3,(H,29,33)/t22-,23-,24+,28-/m1/s1 |
| InChIKey | AEMQDLSNILVURF-QUIZSENMSA-N |
| XLogP | 5.03 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|