C26H20FN3O4S — CID 100885965
(3S,6'R,7'S,7'aS)-6'-benzoyl-5-fluoro-7'-(3-nitrophenyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one (PubChem CID 100885965) has the molecular formula C26H20FN3O4S and a molecular weight of 489.53 g/mol. Its IUPAC name is (3S,6'R,7'S,7'aS)-6'-benzoyl-5-fluoro-7'-(3-nitrophenyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one.
| Compound Name | (3S,6'R,7'S,7'aS)-6'-benzoyl-5-fluoro-7'-(3-nitrophenyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
|---|---|
| PubChem CID | 100885965 |
| Molecular Formula | C26H20FN3O4S |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | (3S,6'R,7'S,7'aS)-6'-benzoyl-5-fluoro-7'-(3-nitrophenyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](c2cccc([N+](=O)[O-])c2)[C@H]2CSCN2[C@@]12C(=O)Nc1ccc(F)cc12 |
| InChI | InChI=1S/C26H20FN3O4S/c27-17-9-10-20-19(12-17)26(25(32)28-20)23(24(31)15-5-2-1-3-6-15)22(21-13-35-14-29(21)26)16-7-4-8-18(11-16)30(33)34/h1-12,21-23H,13-14H2,(H,28,32)/t21-,22+,23+,26-/m1/s1 |
| InChIKey | RLNBELBECOHQEU-QTZVNIFKSA-N |
| XLogP | 4.55 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|