C27H21FN2O4S — CID 4886191
6'-(1,3-benzodioxole-5-carbonyl)-5-fluoro-7'-phenylspiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one (PubChem CID 4886191) has the molecular formula C27H21FN2O4S and a molecular weight of 488.54 g/mol. Its IUPAC name is 6'-(1,3-benzodioxole-5-carbonyl)-5-fluoro-7'-phenylspiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one.
| Compound Name | 6'-(1,3-benzodioxole-5-carbonyl)-5-fluoro-7'-phenylspiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
|---|---|
| PubChem CID | 4886191 |
| Molecular Formula | C27H21FN2O4S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 6'-(1,3-benzodioxole-5-carbonyl)-5-fluoro-7'-phenylspiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
| SMILES | O=C(c1ccc2c(c1)OCO2)C1C(c2ccccc2)C2CSCN2C12C(=O)Nc1ccc(F)cc12 |
| InChI | InChI=1S/C27H21FN2O4S/c28-17-7-8-19-18(11-17)27(26(32)29-19)24(25(31)16-6-9-21-22(10-16)34-14-33-21)23(15-4-2-1-3-5-15)20-12-35-13-30(20)27/h1-11,20,23-24H,12-14H2,(H,29,32) |
| InChIKey | ULEDRDXPEYODTR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |