C25H19ClFN3O2S — CID 29021249
(3S,6'S,7'R,7'aR)-7'-(4-chlorophenyl)-5-fluoro-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one (PubChem CID 29021249) has the molecular formula C25H19ClFN3O2S and a molecular weight of 479.96 g/mol. Its IUPAC name is (3S,6'S,7'R,7'aR)-7'-(4-chlorophenyl)-5-fluoro-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one.
| Compound Name | (3S,6'S,7'R,7'aR)-7'-(4-chlorophenyl)-5-fluoro-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
|---|---|
| PubChem CID | 29021249 |
| Molecular Formula | C25H19ClFN3O2S |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | (3S,6'S,7'R,7'aR)-7'-(4-chlorophenyl)-5-fluoro-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
| SMILES | O=C(c1cccnc1)[C@H]1[C@H](c2ccc(Cl)cc2)[C@@H]2CSCN2[C@@]12C(=O)Nc1ccc(F)cc12 |
| InChI | InChI=1S/C25H19ClFN3O2S/c26-16-5-3-14(4-6-16)21-20-12-33-13-30(20)25(22(21)23(31)15-2-1-9-28-11-15)18-10-17(27)7-8-19(18)29-24(25)32/h1-11,20-22H,12-13H2,(H,29,32)/t20-,21+,22+,25+/m0/s1 |
| InChIKey | MXYHLTNFNXEKMO-IYXIZZNPSA-N |
| XLogP | 4.69 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |