C26H22ClN3O2S — CID 4891388
7'-(4-chlorophenyl)-5-methyl-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one (PubChem CID 4891388) has the molecular formula C26H22ClN3O2S and a molecular weight of 476.00 g/mol. Its IUPAC name is 7'-(4-chlorophenyl)-5-methyl-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one.
| Compound Name | 7'-(4-chlorophenyl)-5-methyl-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
|---|---|
| PubChem CID | 4891388 |
| Molecular Formula | C26H22ClN3O2S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 7'-(4-chlorophenyl)-5-methyl-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
| SMILES | Cc1ccc2c(c1)C1(C(=O)N2)C(C(=O)c2cccnc2)C(c2ccc(Cl)cc2)C2CSCN21 |
| InChI | InChI=1S/C26H22ClN3O2S/c1-15-4-9-20-19(11-15)26(25(32)29-20)23(24(31)17-3-2-10-28-12-17)22(21-13-33-14-30(21)26)16-5-7-18(27)8-6-16/h2-12,21-23H,13-14H2,1H3,(H,29,32) |
| InChIKey | KGHZUJBAAISBOC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |