C27H24N4O4S — CID 40937157
(3R,6'R,7'R,7'aS)-5,7-dimethyl-7'-(4-nitrophenyl)-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one (PubChem CID 40937157) has the molecular formula C27H24N4O4S and a molecular weight of 500.58 g/mol. Its IUPAC name is (3R,6'R,7'R,7'aS)-5,7-dimethyl-7'-(4-nitrophenyl)-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one.
| Compound Name | (3R,6'R,7'R,7'aS)-5,7-dimethyl-7'-(4-nitrophenyl)-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
|---|---|
| PubChem CID | 40937157 |
| Molecular Formula | C27H24N4O4S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | (3R,6'R,7'R,7'aS)-5,7-dimethyl-7'-(4-nitrophenyl)-6'-(pyridine-3-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
| SMILES | Cc1cc(C)c2c(c1)[C@@]1(C(=O)N2)[C@H](C(=O)c2cccnc2)[C@H](c2ccc([N+](=O)[O-])cc2)[C@H]2CSCN21 |
| InChI | InChI=1S/C27H24N4O4S/c1-15-10-16(2)24-20(11-15)27(26(33)29-24)23(25(32)18-4-3-9-28-12-18)22(21-13-36-14-30(21)27)17-5-7-19(8-6-17)31(34)35/h3-12,21-23H,13-14H2,1-2H3,(H,29,33)/t21-,22-,23+,27+/m1/s1 |
| InChIKey | ADMFIICMWZIGRN-LAWREARLSA-N |
| XLogP | 4.43 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|