C27H24N2O2S — CID 4886448
6'-benzoyl-5-methyl-7'-phenylspiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one (PubChem CID 4886448) has the molecular formula C27H24N2O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is 6'-benzoyl-5-methyl-7'-phenylspiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one.
| Compound Name | 6'-benzoyl-5-methyl-7'-phenylspiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
|---|---|
| PubChem CID | 4886448 |
| Molecular Formula | C27H24N2O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 6'-benzoyl-5-methyl-7'-phenylspiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
| SMILES | Cc1ccc2c(c1)C1(C(=O)N2)C(C(=O)c2ccccc2)C(c2ccccc2)C2CSCN21 |
| InChI | InChI=1S/C27H24N2O2S/c1-17-12-13-21-20(14-17)27(26(31)28-21)24(25(30)19-10-6-3-7-11-19)23(18-8-4-2-5-9-18)22-15-32-16-29(22)27/h2-14,22-24H,15-16H2,1H3,(H,28,31) |
| InChIKey | BJMYFYDEORNQRJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |