C25H20N2O5S — CID 27541550
[2-(4-benzamidophenyl)-2-oxoethyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate (PubChem CID 27541550) has the molecular formula C25H20N2O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is [2-(4-benzamidophenyl)-2-oxoethyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate.
| Compound Name | [2-(4-benzamidophenyl)-2-oxoethyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate |
|---|---|
| PubChem CID | 27541550 |
| Molecular Formula | C25H20N2O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [2-(4-benzamidophenyl)-2-oxoethyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)OCC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N2O5S/c28-21(17-10-12-19(13-11-17)26-25(31)18-6-2-1-3-7-18)15-32-24(30)14-27-20-8-4-5-9-22(20)33-16-23(27)29/h1-13H,14-16H2,(H,26,31) |
| InChIKey | GFNSLTPNOMRCLA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |