C19H17N5O4S2 — CID 27543145
N-[2-[2-(2-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]-3-nitrobenzenesulfonamide (PubChem CID 27543145) has the molecular formula C19H17N5O4S2 and a molecular weight of 443.51 g/mol. Its IUPAC name is N-[2-[2-(2-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[2-(2-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 27543145 |
| Molecular Formula | C19H17N5O4S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | N-[2-[2-(2-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccccc1-c1nc2scc(CCNS(=O)(=O)c3cccc([N+](=O)[O-])c3)n2n1 |
| InChI | InChI=1S/C19H17N5O4S2/c1-13-5-2-3-8-17(13)18-21-19-23(22-18)15(12-29-19)9-10-20-30(27,28)16-7-4-6-14(11-16)24(25)26/h2-8,11-12,20H,9-10H2,1H3 |
| InChIKey | ZSFBKJJGMKKDNQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|