C16H20O7S — CID 27552416
[(1S,2R,6R,8S,9R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 4-methylbenzenesulfonate (PubChem CID 27552416) has the molecular formula C16H20O7S and a molecular weight of 356.40 g/mol. Its IUPAC name is [(1S,2R,6R,8S,9R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,6R,8S,9R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 27552416 |
| Molecular Formula | C16H20O7S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [(1S,2R,6R,8S,9R)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CO[C@@H]3[C@H]4OC(C)(C)O[C@H]4O[C@@H]32)cc1 |
| InChI | InChI=1S/C16H20O7S/c1-9-4-6-10(7-5-9)24(17,18)23-11-8-19-13-12(11)20-15-14(13)21-16(2,3)22-15/h4-7,11-15H,8H2,1-3H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | DQNGKHMEUWAYEM-UXXRCYHCSA-N |
| XLogP | 1.34 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|