C25H26N4O7 — CID 27556963
[2-(4-methyl-2-nitroanilino)-2-oxoethyl] 4-[4-(3-methoxy-3-oxopropyl)-3,5-dimethylpyrazol-1-yl]benzoate (PubChem CID 27556963) has the molecular formula C25H26N4O7 and a molecular weight of 494.50 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 4-[4-(3-methoxy-3-oxopropyl)-3,5-dimethylpyrazol-1-yl]benzoate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 4-[4-(3-methoxy-3-oxopropyl)-3,5-dimethylpyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 27556963 |
| Molecular Formula | C25H26N4O7 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 4-[4-(3-methoxy-3-oxopropyl)-3,5-dimethylpyrazol-1-yl]benzoate |
| SMILES | COC(=O)CCc1c(C)nn(-c2ccc(C(=O)OCC(=O)Nc3ccc(C)cc3[N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C25H26N4O7/c1-15-5-11-21(22(13-15)29(33)34)26-23(30)14-36-25(32)18-6-8-19(9-7-18)28-17(3)20(16(2)27-28)10-12-24(31)35-4/h5-9,11,13H,10,12,14H2,1-4H3,(H,26,30) |
| InChIKey | CXUGRBPYYBKLQJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|